C12H18ClIN2 — CID 103217398
[1-(3-chloro-4-iodophenyl)-3-methylpentyl]hydrazine (PubChem CID 103217398) has the molecular formula C12H18ClIN2 and a molecular weight of 352.65 g/mol. Its IUPAC name is [1-(3-chloro-4-iodophenyl)-3-methylpentyl]hydrazine.
| Compound Name | [1-(3-chloro-4-iodophenyl)-3-methylpentyl]hydrazine |
|---|---|
| PubChem CID | 103217398 |
| Molecular Formula | C12H18ClIN2 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | [1-(3-chloro-4-iodophenyl)-3-methylpentyl]hydrazine |
| SMILES | CCC(C)CC(NN)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C12H18ClIN2/c1-3-8(2)6-12(16-15)9-4-5-11(14)10(13)7-9/h4-5,7-8,12,16H,3,6,15H2,1-2H3 |
| InChIKey | XMUKSTLHNGMASP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|