C12H16BrF3N2O2 — CID 103217513
[1-(2-bromo-5-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine (PubChem CID 103217513) has the molecular formula C12H16BrF3N2O2 and a molecular weight of 357.17 g/mol. Its IUPAC name is [1-(2-bromo-5-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine.
| Compound Name | [1-(2-bromo-5-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103217513 |
| Molecular Formula | C12H16BrF3N2O2 |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | [1-(2-bromo-5-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine |
| SMILES | COc1ccc(Br)c(CC(COCC(F)(F)F)NN)c1 |
| InChI | InChI=1S/C12H16BrF3N2O2/c1-19-10-2-3-11(13)8(5-10)4-9(18-17)6-20-7-12(14,15)16/h2-3,5,9,18H,4,6-7,17H2,1H3 |
| InChIKey | DBGKVPRIZIQUKL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|