C14H22BrNO — CID 65325458
1-(2-bromo-5-methoxyphenyl)-N-ethylpentan-2-amine (PubChem CID 65325458) has the molecular formula C14H22BrNO and a molecular weight of 300.24 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-N-ethylpentan-2-amine.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-N-ethylpentan-2-amine |
|---|---|
| PubChem CID | 65325458 |
| Molecular Formula | C14H22BrNO |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-N-ethylpentan-2-amine |
| SMILES | CCCC(Cc1cc(OC)ccc1Br)NCC |
| InChI | InChI=1S/C14H22BrNO/c1-4-6-12(16-5-2)9-11-10-13(17-3)7-8-14(11)15/h7-8,10,12,16H,4-6,9H2,1-3H3 |
| InChIKey | VSDXLJLUUWGPCX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |