C18H30BrNO — CID 115862221
1-(2-bromo-5-methoxyphenyl)-N,3-diethylheptan-2-amine (PubChem CID 115862221) has the molecular formula C18H30BrNO and a molecular weight of 356.35 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-N,3-diethylheptan-2-amine.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-N,3-diethylheptan-2-amine |
|---|---|
| PubChem CID | 115862221 |
| Molecular Formula | C18H30BrNO |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-N,3-diethylheptan-2-amine |
| SMILES | CCCCC(CC)C(Cc1cc(OC)ccc1Br)NCC |
| InChI | InChI=1S/C18H30BrNO/c1-5-8-9-14(6-2)18(20-7-3)13-15-12-16(21-4)10-11-17(15)19/h10-12,14,18,20H,5-9,13H2,1-4H3 |
| InChIKey | GEDJNEGUXQQTHH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |