C15H24BrNO — CID 115862124
1-(2-bromo-5-methoxyphenyl)-N,3-dimethylhexan-2-amine (PubChem CID 115862124) has the molecular formula C15H24BrNO and a molecular weight of 314.27 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-N,3-dimethylhexan-2-amine.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-N,3-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 115862124 |
| Molecular Formula | C15H24BrNO |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-N,3-dimethylhexan-2-amine |
| SMILES | CCCC(C)C(Cc1cc(OC)ccc1Br)NC |
| InChI | InChI=1S/C15H24BrNO/c1-5-6-11(2)15(17-3)10-12-9-13(18-4)7-8-14(12)16/h7-9,11,15,17H,5-6,10H2,1-4H3 |
| InChIKey | PIFADLALLQHBRP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |