C11H21F3N2O2 — CID 103217557
[5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine (PubChem CID 103217557) has the molecular formula C11H21F3N2O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is [5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine.
| Compound Name | [5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103217557 |
| Molecular Formula | C11H21F3N2O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | [5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine |
| SMILES | NNC(CCCC1CCCO1)COCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O2/c12-11(13,14)8-17-7-9(16-15)3-1-4-10-5-2-6-18-10/h9-10,16H,1-8,15H2 |
| InChIKey | XXUGUMZSOWUQRX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|