C11H18F6N2O — CID 103312832
[1,1,1-trifluoro-6-(oxolan-2-yl)-2-(trifluoromethyl)hexan-3-yl]hydrazine (PubChem CID 103312832) has the molecular formula C11H18F6N2O and a molecular weight of 308.27 g/mol. Its IUPAC name is [1,1,1-trifluoro-6-(oxolan-2-yl)-2-(trifluoromethyl)hexan-3-yl]hydrazine.
| Compound Name | [1,1,1-trifluoro-6-(oxolan-2-yl)-2-(trifluoromethyl)hexan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103312832 |
| Molecular Formula | C11H18F6N2O |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [1,1,1-trifluoro-6-(oxolan-2-yl)-2-(trifluoromethyl)hexan-3-yl]hydrazine |
| SMILES | NNC(CCCC1CCCO1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H18F6N2O/c12-10(13,14)9(11(15,16)17)8(19-18)5-1-3-7-4-2-6-20-7/h7-9,19H,1-6,18H2 |
| InChIKey | RWCKNUHDADWGLD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|