C12H18F3N3O — CID 103217657
[1-(5-ethyl-2-pyridinyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine (PubChem CID 103217657) has the molecular formula C12H18F3N3O and a molecular weight of 277.29 g/mol. Its IUPAC name is [1-(5-ethyl-2-pyridinyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine.
| Compound Name | [1-(5-ethyl-2-pyridinyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103217657 |
| Molecular Formula | C12H18F3N3O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | [1-(5-ethyl-2-pyridinyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine |
| SMILES | CCc1ccc(CC(COCC(F)(F)F)NN)nc1 |
| InChI | InChI=1S/C12H18F3N3O/c1-2-9-3-4-10(17-6-9)5-11(18-16)7-19-8-12(13,14)15/h3-4,6,11,18H,2,5,7-8,16H2,1H3 |
| InChIKey | RGTFNKPFIZQALU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|