C22H18F2N4O5 — CID 10321814
6-[(3,4-difluorophenyl)methyl]-N-[(2-methoxy-4-pyridinyl)methyl]-8-methyl-5,7-dioxo-[1,3,4]oxadiazolo[3,2-a]pyridine-2-carboxamide (PubChem CID 10321814) has the molecular formula C22H18F2N4O5 and a molecular weight of 456.41 g/mol. Its IUPAC name is 6-[(3,4-difluorophenyl)methyl]-N-[(2-methoxy-4-pyridinyl)methyl]-8-methyl-5,7-dioxo-[1,3,4]oxadiazolo[3,2-a]pyridine-2-carboxamide.
| Compound Name | 6-[(3,4-difluorophenyl)methyl]-N-[(2-methoxy-4-pyridinyl)methyl]-8-methyl-5,7-dioxo-[1,3,4]oxadiazolo[3,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 10321814 |
| Molecular Formula | C22H18F2N4O5 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 6-[(3,4-difluorophenyl)methyl]-N-[(2-methoxy-4-pyridinyl)methyl]-8-methyl-5,7-dioxo-[1,3,4]oxadiazolo[3,2-a]pyridine-2-carboxamide |
| SMILES | COc1cc(CNC(=O)C2=NN3C(=O)C(Cc4ccc(F)c(F)c4)C(=O)C(C)=C3O2)ccn1 |
| InChI | InChI=1S/C22H18F2N4O5/c1-11-18(29)14(7-12-3-4-15(23)16(24)8-12)21(31)28-22(11)33-20(27-28)19(30)26-10-13-5-6-25-17(9-13)32-2/h3-6,8-9,14H,7,10H2,1-2H3,(H,26,30) |
| InChIKey | MWTKXIMCIKNDAQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|