C11H17N5O2 — CID 103218209
5-amino-2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyridazin-3-one (PubChem CID 103218209) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 5-amino-2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyridazin-3-one.
| Compound Name | 5-amino-2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103218209 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 5-amino-2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyridazin-3-one |
| SMILES | CN1CCN(C(=O)Cn2ncc(N)cc2=O)CC1 |
| InChI | InChI=1S/C11H17N5O2/c1-14-2-4-15(5-3-14)11(18)8-16-10(17)6-9(12)7-13-16/h6-7H,2-5,8,12H2,1H3 |
| InChIKey | FJYJHUMFVGGYED-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |