C24H29NO6S — CID 10321971
2,2-dimethylpropanoyloxymethyl (2S,5R,6Z)-3,3-dimethyl-7-oxo-6-(2-oxo-4-phenylbutylidene)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 10321971) has the molecular formula C24H29NO6S and a molecular weight of 459.56 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (2S,5R,6Z)-3,3-dimethyl-7-oxo-6-(2-oxo-4-phenylbutylidene)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6Z)-3,3-dimethyl-7-oxo-6-(2-oxo-4-phenylbutylidene)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 10321971 |
| Molecular Formula | C24H29NO6S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6Z)-3,3-dimethyl-7-oxo-6-(2-oxo-4-phenylbutylidene)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)[C@@H]1N2C(=O)/C(=C/C(=O)CCc3ccccc3)[C@H]2SC1(C)C |
| InChI | InChI=1S/C24H29NO6S/c1-23(2,3)22(29)31-14-30-21(28)18-24(4,5)32-20-17(19(27)25(18)20)13-16(26)12-11-15-9-7-6-8-10-15/h6-10,13,18,20H,11-12,14H2,1-5H3/b17-13-/t18-,20+/m0/s1 |
| InChIKey | UAENBDCCBMNINM-MCHDXUEESA-N |
| XLogP | 3.27 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|