C11H17IN2 — CID 103220678
N'-[(4-iodophenyl)methyl]-N-methylpropane-1,3-diamine (PubChem CID 103220678) has the molecular formula C11H17IN2 and a molecular weight of 304.18 g/mol. Its IUPAC name is N'-[(4-iodophenyl)methyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[(4-iodophenyl)methyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 103220678 |
| Molecular Formula | C11H17IN2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N'-[(4-iodophenyl)methyl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNCc1ccc(I)cc1 |
| InChI | InChI=1S/C11H17IN2/c1-13-7-2-8-14-9-10-3-5-11(12)6-4-10/h3-6,13-14H,2,7-9H2,1H3 |
| InChIKey | DRSRZNONVVNXPE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|