C14H17ClIN3OS — CID 103220766
N-(4-carbamothioyl-1-methylpiperidin-4-yl)-3-chloro-4-iodobenzamide (PubChem CID 103220766) has the molecular formula C14H17ClIN3OS and a molecular weight of 437.73 g/mol. Its IUPAC name is N-(4-carbamothioyl-1-methylpiperidin-4-yl)-3-chloro-4-iodobenzamide.
| Compound Name | N-(4-carbamothioyl-1-methylpiperidin-4-yl)-3-chloro-4-iodobenzamide |
|---|---|
| PubChem CID | 103220766 |
| Molecular Formula | C14H17ClIN3OS |
| Molecular Weight | 437.73 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | N-(4-carbamothioyl-1-methylpiperidin-4-yl)-3-chloro-4-iodobenzamide |
| SMILES | CN1CCC(NC(=O)c2ccc(I)c(Cl)c2)(C(N)=S)CC1 |
| InChI | InChI=1S/C14H17ClIN3OS/c1-19-6-4-14(5-7-19,13(17)21)18-12(20)9-2-3-11(16)10(15)8-9/h2-3,8H,4-7H2,1H3,(H2,17,21)(H,18,20) |
| InChIKey | NSBQYEDSDOWKCI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|