C14H17Cl2N3OS — CID 61123543
N-(4-carbamothioyl-1-methylpiperidin-4-yl)-2,3-dichlorobenzamide (PubChem CID 61123543) has the molecular formula C14H17Cl2N3OS and a molecular weight of 346.28 g/mol. Its IUPAC name is N-(4-carbamothioyl-1-methylpiperidin-4-yl)-2,3-dichlorobenzamide.
| Compound Name | N-(4-carbamothioyl-1-methylpiperidin-4-yl)-2,3-dichlorobenzamide |
|---|---|
| PubChem CID | 61123543 |
| Molecular Formula | C14H17Cl2N3OS |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | N-(4-carbamothioyl-1-methylpiperidin-4-yl)-2,3-dichlorobenzamide |
| SMILES | CN1CCC(NC(=O)c2cccc(Cl)c2Cl)(C(N)=S)CC1 |
| InChI | InChI=1S/C14H17Cl2N3OS/c1-19-7-5-14(6-8-19,13(17)21)18-12(20)9-3-2-4-10(15)11(9)16/h2-4H,5-8H2,1H3,(H2,17,21)(H,18,20) |
| InChIKey | AMXHFXYHLRDGTK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|