C16H23Cl2N3OS — CID 57229647
N-[2-[(2R)-2-amino-3-sulfanylpropyl]-1-methylpiperidin-2-yl]-2,3-dichlorobenzamide (PubChem CID 57229647) has the molecular formula C16H23Cl2N3OS and a molecular weight of 376.35 g/mol. Its IUPAC name is N-[2-[(2R)-2-amino-3-sulfanylpropyl]-1-methylpiperidin-2-yl]-2,3-dichlorobenzamide.
| Compound Name | N-[2-[(2R)-2-amino-3-sulfanylpropyl]-1-methylpiperidin-2-yl]-2,3-dichlorobenzamide |
|---|---|
| PubChem CID | 57229647 |
| Molecular Formula | C16H23Cl2N3OS |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[2-[(2R)-2-amino-3-sulfanylpropyl]-1-methylpiperidin-2-yl]-2,3-dichlorobenzamide |
| SMILES | CN1CCCCC1(C[C@@H](N)CS)NC(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H23Cl2N3OS/c1-21-8-3-2-7-16(21,9-11(19)10-23)20-15(22)12-5-4-6-13(17)14(12)18/h4-6,11,23H,2-3,7-10,19H2,1H3,(H,20,22)/t11-,16?/m1/s1 |
| InChIKey | DWKMXEDFGMEADN-ZVDHGWRTSA-N |
| XLogP | 3.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|