C12H19N5OS — CID 103510987
N-(4-carbamothioyl-1-methylpiperidin-4-yl)-3-methylimidazole-4-carboxamide (PubChem CID 103510987) has the molecular formula C12H19N5OS and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(4-carbamothioyl-1-methylpiperidin-4-yl)-3-methylimidazole-4-carboxamide.
| Compound Name | N-(4-carbamothioyl-1-methylpiperidin-4-yl)-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 103510987 |
| Molecular Formula | C12H19N5OS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-(4-carbamothioyl-1-methylpiperidin-4-yl)-3-methylimidazole-4-carboxamide |
| SMILES | CN1CCC(NC(=O)c2cncn2C)(C(N)=S)CC1 |
| InChI | InChI=1S/C12H19N5OS/c1-16-5-3-12(4-6-16,11(13)19)15-10(18)9-7-14-8-17(9)2/h7-8H,3-6H2,1-2H3,(H2,13,19)(H,15,18) |
| InChIKey | OTHPDGALZFTLQI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|