C15H26N4O4 — CID 103220950
tert-butyl N-[2-[[1-(2-methoxypropyl)-6-oxopyridazin-4-yl]amino]ethyl]carbamate (PubChem CID 103220950) has the molecular formula C15H26N4O4 and a molecular weight of 326.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(2-methoxypropyl)-6-oxopyridazin-4-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(2-methoxypropyl)-6-oxopyridazin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 103220950 |
| Molecular Formula | C15H26N4O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | tert-butyl N-[2-[[1-(2-methoxypropyl)-6-oxopyridazin-4-yl]amino]ethyl]carbamate |
| SMILES | COC(C)Cn1ncc(NCCNC(=O)OC(C)(C)C)cc1=O |
| InChI | InChI=1S/C15H26N4O4/c1-11(22-5)10-19-13(20)8-12(9-18-19)16-6-7-17-14(21)23-15(2,3)4/h8-9,11,16H,6-7,10H2,1-5H3,(H,17,21) |
| InChIKey | GOTDDTSNCMGSIF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|