C15H23N3O4 — CID 141413882
methyl 2-[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-pyridinyl]acetate (PubChem CID 141413882) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is methyl 2-[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-pyridinyl]acetate.
| Compound Name | methyl 2-[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 141413882 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | methyl 2-[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cncc(NCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H23N3O4/c1-15(2,3)22-14(20)18-6-5-17-12-7-11(9-16-10-12)8-13(19)21-4/h7,9-10,17H,5-6,8H2,1-4H3,(H,18,20) |
| InChIKey | QWUIVYCZLVRECR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|