C30H41NO3 — CID 10322173
[(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-hexyl-4H-pyridine-3-carboxylate (PubChem CID 10322173) has the molecular formula C30H41NO3 and a molecular weight of 463.66 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-hexyl-4H-pyridine-3-carboxylate.
| Compound Name | [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-hexyl-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10322173 |
| Molecular Formula | C30H41NO3 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-hexyl-4H-pyridine-3-carboxylate |
| SMILES | CCCCCCN1C=CCC(C(=O)O[C@@H]2CC[C@H]3[C@@H]4CCc5cc(O)ccc5[C@H]4CC[C@]23C)=C1 |
| InChI | InChI=1S/C30H41NO3/c1-3-4-5-6-17-31-18-7-8-22(20-31)29(33)34-28-14-13-27-26-11-9-21-19-23(32)10-12-24(21)25(26)15-16-30(27,28)2/h7,10,12,18-20,25-28,32H,3-6,8-9,11,13-17H2,1-2H3/t25-,26-,27+,28-,30+/m1/s1 |
| InChIKey | CZUPSICAKZJQPU-IXMSMLDRSA-N |
| XLogP | 6.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|