C14H25N5O — CID 103223360
5-[2-aminoethyl(methyl)amino]-2-(3-pyrrolidin-1-ylpropyl)pyridazin-3-one (PubChem CID 103223360) has the molecular formula C14H25N5O and a molecular weight of 279.39 g/mol. Its IUPAC name is 5-[2-aminoethyl(methyl)amino]-2-(3-pyrrolidin-1-ylpropyl)pyridazin-3-one.
| Compound Name | 5-[2-aminoethyl(methyl)amino]-2-(3-pyrrolidin-1-ylpropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 103223360 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 5-[2-aminoethyl(methyl)amino]-2-(3-pyrrolidin-1-ylpropyl)pyridazin-3-one |
| SMILES | CN(CCN)c1cnn(CCCN2CCCC2)c(=O)c1 |
| InChI | InChI=1S/C14H25N5O/c1-17(10-5-15)13-11-14(20)19(16-12-13)9-4-8-18-6-2-3-7-18/h11-12H,2-10,15H2,1H3 |
| InChIKey | UZMCLUCQXHEEEO-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |