C14H16N6O — CID 103223517
3-[[4-[2-aminoethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl]pyridine-2-carbonitrile (PubChem CID 103223517) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-[[4-[2-aminoethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[[4-[2-aminoethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103223517 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3-[[4-[2-aminoethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl]pyridine-2-carbonitrile |
| SMILES | CN(CCN)c1cnn(Cc2cccnc2C#N)c(=O)c1 |
| InChI | InChI=1S/C14H16N6O/c1-19(6-4-15)12-7-14(21)20(18-9-12)10-11-3-2-5-17-13(11)8-16/h2-3,5,7,9H,4,6,10,15H2,1H3 |
| InChIKey | QIOQNNFVWULYAT-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |