C25H29F3N2O4 — CID 10322824
6-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-4-[2-(trifluoromethoxy)phenyl]hex-1-en-3-ol (PubChem CID 10322824) has the molecular formula C25H29F3N2O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is 6-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-4-[2-(trifluoromethoxy)phenyl]hex-1-en-3-ol.
| Compound Name | 6-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-4-[2-(trifluoromethoxy)phenyl]hex-1-en-3-ol |
|---|---|
| PubChem CID | 10322824 |
| Molecular Formula | C25H29F3N2O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 6-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-4-[2-(trifluoromethoxy)phenyl]hex-1-en-3-ol |
| SMILES | C=CC(O)C(CCN1CCN(c2cccc3c2OCCO3)CC1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C25H29F3N2O4/c1-2-21(31)18(19-6-3-4-8-22(19)34-25(26,27)28)10-11-29-12-14-30(15-13-29)20-7-5-9-23-24(20)33-17-16-32-23/h2-9,18,21,31H,1,10-17H2 |
| InChIKey | WSHJMOWTCDMPCL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|