C22H29F3N2O2 — CID 143239351
1-(2,3-dihydro-1,4-benzodioxin-5-yl)-4-[(4E,6Z)-5-(trifluoromethyl)nona-4,6-dienyl]piperazine (PubChem CID 143239351) has the molecular formula C22H29F3N2O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-5-yl)-4-[(4E,6Z)-5-(trifluoromethyl)nona-4,6-dienyl]piperazine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-5-yl)-4-[(4E,6Z)-5-(trifluoromethyl)nona-4,6-dienyl]piperazine |
|---|---|
| PubChem CID | 143239351 |
| Molecular Formula | C22H29F3N2O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-5-yl)-4-[(4E,6Z)-5-(trifluoromethyl)nona-4,6-dienyl]piperazine |
| SMILES | CC/C=C\C(=C/CCCN1CCN(c2cccc3c2OCCO3)CC1)C(F)(F)F |
| InChI | InChI=1S/C22H29F3N2O2/c1-2-3-7-18(22(23,24)25)8-4-5-11-26-12-14-27(15-13-26)19-9-6-10-20-21(19)29-17-16-28-20/h3,6-10H,2,4-5,11-17H2,1H3/b7-3-,18-8+ |
| InChIKey | IXOUDFPKRQCFOY-CAGBHJBMSA-N |
| XLogP | 4.81 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|