C12H21NO2S — CID 103228622
N-ethyl-3-methoxy-2-(2-thiophen-2-ylethoxy)propan-1-amine (PubChem CID 103228622) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is N-ethyl-3-methoxy-2-(2-thiophen-2-ylethoxy)propan-1-amine.
| Compound Name | N-ethyl-3-methoxy-2-(2-thiophen-2-ylethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103228622 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | N-ethyl-3-methoxy-2-(2-thiophen-2-ylethoxy)propan-1-amine |
| SMILES | CCNCC(COC)OCCc1cccs1 |
| InChI | InChI=1S/C12H21NO2S/c1-3-13-9-11(10-14-2)15-7-6-12-5-4-8-16-12/h4-5,8,11,13H,3,6-7,9-10H2,1-2H3 |
| InChIKey | HRGVULPVKNTKRQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |