C13H13ClF3NO2 — CID 103230235
(Z)-4-[2-chloro-6-(trifluoromethyl)anilino]-2-ethylbut-2-enoic acid (PubChem CID 103230235) has the molecular formula C13H13ClF3NO2 and a molecular weight of 307.70 g/mol. Its IUPAC name is (Z)-4-[2-chloro-6-(trifluoromethyl)anilino]-2-ethylbut-2-enoic acid.
| Compound Name | (Z)-4-[2-chloro-6-(trifluoromethyl)anilino]-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 103230235 |
| Molecular Formula | C13H13ClF3NO2 |
| Molecular Weight | 307.70 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | (Z)-4-[2-chloro-6-(trifluoromethyl)anilino]-2-ethylbut-2-enoic acid |
| SMILES | CC/C(=C/CNc1c(Cl)cccc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H13ClF3NO2/c1-2-8(12(19)20)6-7-18-11-9(13(15,16)17)4-3-5-10(11)14/h3-6,18H,2,7H2,1H3,(H,19,20)/b8-6- |
| InChIKey | PGOZOAQNTHJSOK-VURMDHGXSA-N |
| XLogP | 4.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.70 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|