C13H13ClN2O4S — CID 103233204
4-[(5-chloro-2,4-dimethoxyanilino)methyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 103233204) has the molecular formula C13H13ClN2O4S and a molecular weight of 328.78 g/mol. Its IUPAC name is 4-[(5-chloro-2,4-dimethoxyanilino)methyl]-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-[(5-chloro-2,4-dimethoxyanilino)methyl]-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 103233204 |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 4-[(5-chloro-2,4-dimethoxyanilino)methyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | COc1cc(OC)c(NCc2csc(C(=O)O)n2)cc1Cl |
| InChI | InChI=1S/C13H13ClN2O4S/c1-19-10-4-11(20-2)9(3-8(10)14)15-5-7-6-21-12(16-7)13(17)18/h3-4,6,15H,5H2,1-2H3,(H,17,18) |
| InChIKey | COBQCCSYIOFXNM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|