About (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one
(3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one (PubChem CID 10323551) has the molecular formula C30H27NOSe
and a molecular weight of 496.51 g/mol. Its IUPAC name is (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one |
| PubChem CID | 10323551 |
| Molecular Formula | C30H27NOSe |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one |
| SMILES | O=C1N(Cc2ccccc2)C[C@H](c2ccccc2)[C@]1(Cc1ccccc1)[Se]c1ccccc1 |
| InChI | InChI=1S/C30H27NOSe/c32-29-30(21-24-13-5-1-6-14-24,33-27-19-11-4-12-20-27)28(26-17-9-3-10-18-26)23-31(29)22-25-15-7-2-8-16-25/h1-20,28H,21-23H2/t28-,30+/m1/s1 |
| InChIKey | YPCKWLLVYSHOCB-DGPALRBDSA-N |
| XLogP | 5.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one?
The IUPAC name of (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one (CID 10323551) is (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one.
What is the SMILES notation for (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one?
The canonical SMILES for (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one is O=C1N(Cc2ccccc2)C[C@H](c2ccccc2)[C@]1(Cc1ccccc1)[Se]c1ccccc1.
What is the InChIKey of (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one?
The InChIKey is YPCKWLLVYSHOCB-DGPALRBDSA-N. The full InChI is InChI=1S/C30H27NOSe/c32-29-30(21-24-13-5-1-6-14-24,33-27-19-11-4-12-20-27)28(26-17-9-3-10-18-26)23-31(29)22-25-15-7-2-8-16-25/h1-20,28H,21-23H2/t28-,30+/m1/s1.
What are the key properties of (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one?
(3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one has a molecular weight of 496.51 g/mol, XLogP of 5.24, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one is sourced from PubChem (CID 10323551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).