C30H27NOSe — CID 10323551
(3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one (PubChem CID 10323551) has the molecular formula C30H27NOSe and a molecular weight of 496.51 g/mol. Its IUPAC name is (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one.
| Compound Name | (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10323551 |
| Molecular Formula | C30H27NOSe |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (3S,4S)-1,3-dibenzyl-4-phenyl-3-phenylselanylpyrrolidin-2-one |
| SMILES | O=C1N(Cc2ccccc2)C[C@H](c2ccccc2)[C@]1(Cc1ccccc1)[Se]c1ccccc1 |
| InChI | InChI=1S/C30H27NOSe/c32-29-30(21-24-13-5-1-6-14-24,33-27-19-11-4-12-20-27)28(26-17-9-3-10-18-26)23-31(29)22-25-15-7-2-8-16-25/h1-20,28H,21-23H2/t28-,30+/m1/s1 |
| InChIKey | YPCKWLLVYSHOCB-DGPALRBDSA-N |
| XLogP | 5.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|