C10H15NO3S — CID 103235571
3-hydroxy-4-(2-thiophen-2-ylethylamino)butanoic acid (PubChem CID 103235571) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 3-hydroxy-4-(2-thiophen-2-ylethylamino)butanoic acid.
| Compound Name | 3-hydroxy-4-(2-thiophen-2-ylethylamino)butanoic acid |
|---|---|
| PubChem CID | 103235571 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 3-hydroxy-4-(2-thiophen-2-ylethylamino)butanoic acid |
| SMILES | O=C(O)CC(O)CNCCc1cccs1 |
| InChI | InChI=1S/C10H15NO3S/c12-8(6-10(13)14)7-11-4-3-9-2-1-5-15-9/h1-2,5,8,11-12H,3-4,6-7H2,(H,13,14) |
| InChIKey | SWWBFNWHHNTUDD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|