C11H15NO2S — CID 103238692
(E)-3-methyl-4-(1-thiophen-2-ylethylamino)but-2-enoic acid (PubChem CID 103238692) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is (E)-3-methyl-4-(1-thiophen-2-ylethylamino)but-2-enoic acid.
| Compound Name | (E)-3-methyl-4-(1-thiophen-2-ylethylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 103238692 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (E)-3-methyl-4-(1-thiophen-2-ylethylamino)but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)CNC(C)c1cccs1 |
| InChI | InChI=1S/C11H15NO2S/c1-8(6-11(13)14)7-12-9(2)10-4-3-5-15-10/h3-6,9,12H,7H2,1-2H3,(H,13,14)/b8-6+ |
| InChIKey | RMTRTGDNRCGWRS-SOFGYWHQSA-N |
| XLogP | 2.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|