C9H14N2O2S — CID 64583236
2-amino-3-(1-thiophen-2-ylethylamino)propanoic acid (PubChem CID 64583236) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-amino-3-(1-thiophen-2-ylethylamino)propanoic acid.
| Compound Name | 2-amino-3-(1-thiophen-2-ylethylamino)propanoic acid |
|---|---|
| PubChem CID | 64583236 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-amino-3-(1-thiophen-2-ylethylamino)propanoic acid |
| SMILES | CC(NCC(N)C(=O)O)c1cccs1 |
| InChI | InChI=1S/C9H14N2O2S/c1-6(8-3-2-4-14-8)11-5-7(10)9(12)13/h2-4,6-7,11H,5,10H2,1H3,(H,12,13) |
| InChIKey | DUCLZUPVODLTEN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |