C10H13NO2S — CID 103257806
2-[[[(1S)-1-thiophen-2-ylethyl]amino]methyl]prop-2-enoic acid (PubChem CID 103257806) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-[[[(1S)-1-thiophen-2-ylethyl]amino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[[(1S)-1-thiophen-2-ylethyl]amino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103257806 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 2-[[[(1S)-1-thiophen-2-ylethyl]amino]methyl]prop-2-enoic acid |
| SMILES | C=C(CN[C@@H](C)c1cccs1)C(=O)O |
| InChI | InChI=1S/C10H13NO2S/c1-7(10(12)13)6-11-8(2)9-4-3-5-14-9/h3-5,8,11H,1,6H2,2H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | AGGJZTSKPBGRQI-QMMMGPOBSA-N |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|