C9H18N2O4S — CID 103239030
ethyl 2-[[2-(methanesulfonamido)ethylamino]methyl]prop-2-enoate (PubChem CID 103239030) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is ethyl 2-[[2-(methanesulfonamido)ethylamino]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[2-(methanesulfonamido)ethylamino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 103239030 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | ethyl 2-[[2-(methanesulfonamido)ethylamino]methyl]prop-2-enoate |
| SMILES | C=C(CNCCNS(C)(=O)=O)C(=O)OCC |
| InChI | InChI=1S/C9H18N2O4S/c1-4-15-9(12)8(2)7-10-5-6-11-16(3,13)14/h10-11H,2,4-7H2,1,3H3 |
| InChIKey | OUHZQCMJYLCGJI-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|