C15H20FNO2 — CID 103239050
methyl (Z)-2-ethyl-4-[2-(3-fluorophenyl)ethylamino]but-2-enoate (PubChem CID 103239050) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is methyl (Z)-2-ethyl-4-[2-(3-fluorophenyl)ethylamino]but-2-enoate.
| Compound Name | methyl (Z)-2-ethyl-4-[2-(3-fluorophenyl)ethylamino]but-2-enoate |
|---|---|
| PubChem CID | 103239050 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | methyl (Z)-2-ethyl-4-[2-(3-fluorophenyl)ethylamino]but-2-enoate |
| SMILES | CC/C(=C/CNCCc1cccc(F)c1)C(=O)OC |
| InChI | InChI=1S/C15H20FNO2/c1-3-13(15(18)19-2)8-10-17-9-7-12-5-4-6-14(16)11-12/h4-6,8,11,17H,3,7,9-10H2,1-2H3/b13-8- |
| InChIKey | AHZRJYAZNFBRDY-JYRVWZFOSA-N |
| XLogP | 2.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|