C14H25NO2 — CID 103240089
4-(2-cyclohexylethylamino)-2-ethylbut-2-enoic acid (PubChem CID 103240089) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 4-(2-cyclohexylethylamino)-2-ethylbut-2-enoic acid.
| Compound Name | 4-(2-cyclohexylethylamino)-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 103240089 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 4-(2-cyclohexylethylamino)-2-ethylbut-2-enoic acid |
| SMILES | CCC(=CCNCCC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C14H25NO2/c1-2-13(14(16)17)9-11-15-10-8-12-6-4-3-5-7-12/h9,12,15H,2-8,10-11H2,1H3,(H,16,17) |
| InChIKey | UQHAVLFJAHOFSE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|