C13H23NO3 — CID 106137074
2-ethyl-4-[(4-hydroxycyclohexyl)methylamino]but-2-enoic acid (PubChem CID 106137074) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-ethyl-4-[(4-hydroxycyclohexyl)methylamino]but-2-enoic acid.
| Compound Name | 2-ethyl-4-[(4-hydroxycyclohexyl)methylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 106137074 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 2-ethyl-4-[(4-hydroxycyclohexyl)methylamino]but-2-enoic acid |
| SMILES | CCC(=CCNCC1CCC(O)CC1)C(=O)O |
| InChI | InChI=1S/C13H23NO3/c1-2-11(13(16)17)7-8-14-9-10-3-5-12(15)6-4-10/h7,10,12,14-15H,2-6,8-9H2,1H3,(H,16,17) |
| InChIKey | CLTFXLBYDRYTNO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|