C13H23NO2 — CID 103235504
2-ethyl-4-[(2-methylcyclohexyl)amino]but-2-enoic acid (PubChem CID 103235504) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 2-ethyl-4-[(2-methylcyclohexyl)amino]but-2-enoic acid.
| Compound Name | 2-ethyl-4-[(2-methylcyclohexyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 103235504 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2-ethyl-4-[(2-methylcyclohexyl)amino]but-2-enoic acid |
| SMILES | CCC(=CCNC1CCCCC1C)C(=O)O |
| InChI | InChI=1S/C13H23NO2/c1-3-11(13(15)16)8-9-14-12-7-5-4-6-10(12)2/h8,10,12,14H,3-7,9H2,1-2H3,(H,15,16) |
| InChIKey | YCPYGSMFSHTCCM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|