C8H15NO4S — CID 103240246
3-methyl-4-(2-methylsulfonylethylamino)but-2-enoic acid (PubChem CID 103240246) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-methyl-4-(2-methylsulfonylethylamino)but-2-enoic acid.
| Compound Name | 3-methyl-4-(2-methylsulfonylethylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 103240246 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 3-methyl-4-(2-methylsulfonylethylamino)but-2-enoic acid |
| SMILES | CC(=CC(=O)O)CNCCS(C)(=O)=O |
| InChI | InChI=1S/C8H15NO4S/c1-7(5-8(10)11)6-9-3-4-14(2,12)13/h5,9H,3-4,6H2,1-2H3,(H,10,11) |
| InChIKey | XNYLMFFLWCERAL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|