4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid

C9H15NO4S — CID 103231384

IUPAC4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid
SMILESCC(=CC(=O)O)CNC1CCS(=O)(=O)C1
InChIInChI=1S/C9H15NO4S/c1-7(4-9(11)12)5-10-8-2-3-15(13,14)6-8/h4,8,10H,2-3,5-6H2,1H3,(H,11,12)
InChIKeyPQSSEMBIGYIGKX-UHFFFAOYSA-N
MW233.29 g/mol
LogP-0.21
Rot. Bonds4

About 4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid

4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid (PubChem CID 103231384) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid.

Molecular Properties

Compound Name4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid
PubChem CID103231384
Molecular FormulaC9H15NO4S
Molecular Weight233.29 g/mol
Exact Mass233.07
IUPAC Name4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid
SMILESCC(=CC(=O)O)CNC1CCS(=O)(=O)C1
InChIInChI=1S/C9H15NO4S/c1-7(4-9(11)12)5-10-8-2-3-15(13,14)6-8/h4,8,10H,2-3,5-6H2,1H3,(H,11,12)
InChIKeyPQSSEMBIGYIGKX-UHFFFAOYSA-N
XLogP-0.21
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.29
LogP ≤ 5-0.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid?
The IUPAC name of 4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid (CID 103231384) is 4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid.
What is the SMILES notation for 4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid?
The canonical SMILES for 4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid is CC(=CC(=O)O)CNC1CCS(=O)(=O)C1.
What is the InChIKey of 4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid?
The InChIKey is PQSSEMBIGYIGKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4S/c1-7(4-9(11)12)5-10-8-2-3-15(13,14)6-8/h4,8,10H,2-3,5-6H2,1H3,(H,11,12).
What are the key properties of 4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid?
4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid has a molecular weight of 233.29 g/mol, XLogP of -0.21, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dioxothiolan-3-yl)amino]-3-methylbut-2-enoic acid is sourced from PubChem (CID 103231384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).