C12H14F3NO2S — CID 103240857
3,3,3-trifluoro-2-[(2-phenylsulfanylethylamino)methyl]propanoic acid (PubChem CID 103240857) has the molecular formula C12H14F3NO2S and a molecular weight of 293.31 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(2-phenylsulfanylethylamino)methyl]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-[(2-phenylsulfanylethylamino)methyl]propanoic acid |
|---|---|
| PubChem CID | 103240857 |
| Molecular Formula | C12H14F3NO2S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3,3,3-trifluoro-2-[(2-phenylsulfanylethylamino)methyl]propanoic acid |
| SMILES | O=C(O)C(CNCCSc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO2S/c13-12(14,15)10(11(17)18)8-16-6-7-19-9-4-2-1-3-5-9/h1-5,10,16H,6-8H2,(H,17,18) |
| InChIKey | GLGVJUJAGBUQLB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|