C11H19N3O3 — CID 103241415
4-[2-(diethylamino)ethoxy]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 103241415) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethoxy]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(diethylamino)ethoxy]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241415 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 4-[2-(diethylamino)ethoxy]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | CCN(CC)CCOc1nc[nH]c(=O)c1OC |
| InChI | InChI=1S/C11H19N3O3/c1-4-14(5-2)6-7-17-11-9(16-3)10(15)12-8-13-11/h8H,4-7H2,1-3H3,(H,12,13,15) |
| InChIKey | BZSNRCVCIZNOQC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |