C8H10F2N2O2 — CID 103241906
4-(2,2-difluoroethoxy)-2-ethyl-1H-pyrimidin-6-one (PubChem CID 103241906) has the molecular formula C8H10F2N2O2 and a molecular weight of 204.18 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-2-ethyl-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2-difluoroethoxy)-2-ethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241906 |
| Molecular Formula | C8H10F2N2O2 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-2-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1nc(OCC(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C8H10F2N2O2/c1-2-6-11-7(13)3-8(12-6)14-4-5(9)10/h3,5H,2,4H2,1H3,(H,11,12,13) |
| InChIKey | AMYAYOXJAGZEEB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |