C12H15NO2S — CID 103242950
methyl (E)-3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)prop-2-enoate (PubChem CID 103242950) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is methyl (E)-3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)prop-2-enoate.
| Compound Name | methyl (E)-3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)prop-2-enoate |
|---|---|
| PubChem CID | 103242950 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | methyl (E)-3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)prop-2-enoate |
| SMILES | COC(=O)/C=C/NCc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C12H15NO2S/c1-15-12(14)5-6-13-8-10-7-9-3-2-4-11(9)16-10/h5-7,13H,2-4,8H2,1H3/b6-5+ |
| InChIKey | JBXKSGCWOUHMOB-AATRIKPKSA-N |
| XLogP | 2.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|