C12H18N2O2S — CID 103243278
methyl 2-ethyl-4-[(2-methyl-1,3-thiazol-5-yl)methylamino]but-2-enoate (PubChem CID 103243278) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is methyl 2-ethyl-4-[(2-methyl-1,3-thiazol-5-yl)methylamino]but-2-enoate.
| Compound Name | methyl 2-ethyl-4-[(2-methyl-1,3-thiazol-5-yl)methylamino]but-2-enoate |
|---|---|
| PubChem CID | 103243278 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | methyl 2-ethyl-4-[(2-methyl-1,3-thiazol-5-yl)methylamino]but-2-enoate |
| SMILES | CCC(=CCNCc1cnc(C)s1)C(=O)OC |
| InChI | InChI=1S/C12H18N2O2S/c1-4-10(12(15)16-3)5-6-13-7-11-8-14-9(2)17-11/h5,8,13H,4,6-7H2,1-3H3 |
| InChIKey | FLWFBUDHQHVKNG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|