C9H12N2O3 — CID 103243708
(E)-4-[(5-methyl-1,2-oxazol-3-yl)methylamino]but-2-enoic acid (PubChem CID 103243708) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is (E)-4-[(5-methyl-1,2-oxazol-3-yl)methylamino]but-2-enoic acid.
| Compound Name | (E)-4-[(5-methyl-1,2-oxazol-3-yl)methylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 103243708 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (E)-4-[(5-methyl-1,2-oxazol-3-yl)methylamino]but-2-enoic acid |
| SMILES | Cc1cc(CNC/C=C/C(=O)O)no1 |
| InChI | InChI=1S/C9H12N2O3/c1-7-5-8(11-14-7)6-10-4-2-3-9(12)13/h2-3,5,10H,4,6H2,1H3,(H,12,13)/b3-2+ |
| InChIKey | LFVRCNWJBFNCTI-NSCUHMNNSA-N |
| XLogP | 0.71 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|