2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid

C9H14N2O3 — CID 64669367

IUPAC2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid
SMILESCCC(NCc1cc(C)on1)C(=O)O
InChIInChI=1S/C9H14N2O3/c1-3-8(9(12)13)10-5-7-4-6(2)14-11-7/h4,8,10H,3,5H2,1-2H3,(H,12,13)
InChIKeyUFROJRMZKSKXST-UHFFFAOYSA-N
MW198.22 g/mol
LogP0.94
Rot. Bonds5

About 2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid

2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid (PubChem CID 64669367) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid.

Molecular Properties

Compound Name2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid
PubChem CID64669367
Molecular FormulaC9H14N2O3
Molecular Weight198.22 g/mol
Exact Mass198.10
IUPAC Name2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid
SMILESCCC(NCc1cc(C)on1)C(=O)O
InChIInChI=1S/C9H14N2O3/c1-3-8(9(12)13)10-5-7-4-6(2)14-11-7/h4,8,10H,3,5H2,1-2H3,(H,12,13)
InChIKeyUFROJRMZKSKXST-UHFFFAOYSA-N
XLogP0.94
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.22
LogP ≤ 50.94
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid?
The IUPAC name of 2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid (CID 64669367) is 2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid.
What is the SMILES notation for 2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid?
The canonical SMILES for 2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid is CCC(NCc1cc(C)on1)C(=O)O.
What is the InChIKey of 2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid?
The InChIKey is UFROJRMZKSKXST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-3-8(9(12)13)10-5-7-4-6(2)14-11-7/h4,8,10H,3,5H2,1-2H3,(H,12,13).
What are the key properties of 2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid?
2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid has a molecular weight of 198.22 g/mol, XLogP of 0.94, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyl-1,2-oxazol-3-yl)methylamino]butanoic acid is sourced from PubChem (CID 64669367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).