C9H12N2O3 — CID 103243724
methyl (E)-3-[(5-methyl-1,2-oxazol-3-yl)methylamino]prop-2-enoate (PubChem CID 103243724) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is methyl (E)-3-[(5-methyl-1,2-oxazol-3-yl)methylamino]prop-2-enoate.
| Compound Name | methyl (E)-3-[(5-methyl-1,2-oxazol-3-yl)methylamino]prop-2-enoate |
|---|---|
| PubChem CID | 103243724 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | methyl (E)-3-[(5-methyl-1,2-oxazol-3-yl)methylamino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NCc1cc(C)on1 |
| InChI | InChI=1S/C9H12N2O3/c1-7-5-8(11-14-7)6-10-4-3-9(12)13-2/h3-5,10H,6H2,1-2H3/b4-3+ |
| InChIKey | GDTNTFBXBXJSTE-ONEGZZNKSA-N |
| XLogP | 0.76 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|