methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate

C8H9NO3 — CID 131844045

IUPACmethyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate
SMILESCOC(=O)C=Cc1cc(C)on1
InChIInChI=1S/C8H9NO3/c1-6-5-7(9-12-6)3-4-8(10)11-2/h3-5H,1-2H3
InChIKeyYWJPGBKMCHXMJK-UHFFFAOYSA-N
MW167.16 g/mol
LogP1.17
Rot. Bonds2

About methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate

methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate (PubChem CID 131844045) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate.

Molecular Properties

Compound Namemethyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate
PubChem CID131844045
Molecular FormulaC8H9NO3
Molecular Weight167.16 g/mol
Exact Mass167.06
IUPAC Namemethyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate
SMILESCOC(=O)C=Cc1cc(C)on1
InChIInChI=1S/C8H9NO3/c1-6-5-7(9-12-6)3-4-8(10)11-2/h3-5H,1-2H3
InChIKeyYWJPGBKMCHXMJK-UHFFFAOYSA-N
XLogP1.17
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.16
LogP ≤ 51.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate?
The IUPAC name of methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate (CID 131844045) is methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate.
What is the SMILES notation for methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate?
The canonical SMILES for methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate is COC(=O)C=Cc1cc(C)on1.
What is the InChIKey of methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate?
The InChIKey is YWJPGBKMCHXMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c1-6-5-7(9-12-6)3-4-8(10)11-2/h3-5H,1-2H3.
What are the key properties of methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate?
methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate has a molecular weight of 167.16 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate is sourced from PubChem (CID 131844045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).