C9H8N2O3 — CID 119087297
methyl (E)-2-cyano-3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate (PubChem CID 119087297) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is methyl (E)-2-cyano-3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate.
| Compound Name | methyl (E)-2-cyano-3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 119087297 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | methyl (E)-2-cyano-3-(5-methyl-1,2-oxazol-3-yl)prop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/c1cc(C)on1 |
| InChI | InChI=1S/C9H8N2O3/c1-6-3-8(11-14-6)4-7(5-10)9(12)13-2/h3-4H,1-2H3/b7-4+ |
| InChIKey | OXJJLIVALCCEGZ-QPJJXVBHSA-N |
| XLogP | 1.06 |
| TPSA | 76.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|