C13H16FNO2 — CID 103244269
(Z)-4-[1-(4-fluorophenyl)ethylamino]-2-methylbut-2-enoic acid (PubChem CID 103244269) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is (Z)-4-[1-(4-fluorophenyl)ethylamino]-2-methylbut-2-enoic acid.
| Compound Name | (Z)-4-[1-(4-fluorophenyl)ethylamino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 103244269 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (Z)-4-[1-(4-fluorophenyl)ethylamino]-2-methylbut-2-enoic acid |
| SMILES | C/C(=C/CNC(C)c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C13H16FNO2/c1-9(13(16)17)7-8-15-10(2)11-3-5-12(14)6-4-11/h3-7,10,15H,8H2,1-2H3,(H,16,17)/b9-7- |
| InChIKey | WZOLJLPDUUWZOR-CLFYSBASSA-N |
| XLogP | 2.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|