C14H20N2O3 — CID 103247286
(E)-3-methyl-4-[(2-propan-2-yloxy-3-pyridinyl)methylamino]but-2-enoic acid (PubChem CID 103247286) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is (E)-3-methyl-4-[(2-propan-2-yloxy-3-pyridinyl)methylamino]but-2-enoic acid.
| Compound Name | (E)-3-methyl-4-[(2-propan-2-yloxy-3-pyridinyl)methylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 103247286 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (E)-3-methyl-4-[(2-propan-2-yloxy-3-pyridinyl)methylamino]but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)CNCc1cccnc1OC(C)C |
| InChI | InChI=1S/C14H20N2O3/c1-10(2)19-14-12(5-4-6-16-14)9-15-8-11(3)7-13(17)18/h4-7,10,15H,8-9H2,1-3H3,(H,17,18)/b11-7+ |
| InChIKey | GOCRHIJTYVOQPP-YRNVUSSQSA-N |
| XLogP | 1.99 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|